149703-60-6 Usage
Uses
Used in Organic Synthesis:
2,3-DIMETHYL-5-NITRO-6-METHYLAMINO-7-METHYL-QUINOXALINE is used as a synthetic building block for the development of new organic compounds. Its presence in the synthesis process allows for the creation of a wide range of molecules with diverse applications across different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-DIMETHYL-5-NITRO-6-METHYLAMINO-7-METHYL-QUINOXALINE is used as a key intermediate in the synthesis of various drugs and drug candidates. Its unique chemical properties enable the development of novel therapeutic agents with potential applications in treating various medical conditions.
Used in Chemical Research:
2,3-DIMETHYL-5-NITRO-6-METHYLAMINO-7-METHYL-QUINOXALINE is also employed in chemical research as a model compound for studying various reaction mechanisms and exploring new synthetic routes. Its use in research contributes to the advancement of knowledge in the field of organic chemistry and the development of innovative chemical processes.
Used in Material Science:
In the field of material science, 2,3-DIMETHYL-5-NITRO-6-METHYLAMINO-7-METHYL-QUINOXALINE is used as a component in the development of new materials with specific properties. Its incorporation into the synthesis of these materials can lead to the creation of advanced materials with applications in various industries, such as electronics, aerospace, and automotive.
Check Digit Verification of cas no
The CAS Registry Mumber 149703-60-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,7,0 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 149703-60:
(8*1)+(7*4)+(6*9)+(5*7)+(4*0)+(3*3)+(2*6)+(1*0)=146
146 % 10 = 6
So 149703-60-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N4O2/c1-6-5-9-11(15-8(3)7(2)14-9)12(16(17)18)10(6)13-4/h5,13H,1-4H3
