1500-99-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Quinoxalin-2-ylpropanoic acid is used as an anticancer agent for its ability to inhibit the growth of cancer cells. It has shown potential in treating various types of cancer, making it a promising candidate for further research and development in oncology.
3-Quinoxalin-2-ylpropanoic acid is also used as an anti-inflammatory and analgesic agent due to its potential to reduce inflammation and alleviate pain. This makes it a valuable compound for the development of new medications to treat conditions associated with inflammation and pain.
Furthermore, 3-Quinoxalin-2-ylpropanoic acid has the potential to be used in the development of new drug delivery systems, aiming to improve its bioavailability and therapeutic outcomes in various disease treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 1500-99-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,0 and 0 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1500-99:
(6*1)+(5*5)+(4*0)+(3*0)+(2*9)+(1*9)=58
58 % 10 = 8
So 1500-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c14-11(15)6-5-8-7-12-9-3-1-2-4-10(9)13-8/h1-4,7H,5-6H2,(H,14,15)