151155-53-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2,3-Dihydrobenzo[b]furan-7-methanol is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Production:
2,3-DIHYDROBENZO[B]FURAN-7-METHANOL also finds application in the production of agrochemicals, where it can be utilized to create new pesticides or other agricultural products to improve crop protection and yield.
Used in Organic Chemistry Research:
2,3-Dihydrobenzo[b]furan-7-methanol is used as a versatile building block in organic chemistry for the preparation of complex organic molecules. Its ability to undergo various chemical reactions makes it a valuable component in the synthesis of a wide range of organic compounds for research and development purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 151155-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,1,5 and 5 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 151155-53:
(8*1)+(7*5)+(6*1)+(5*1)+(4*5)+(3*5)+(2*5)+(1*3)=102
102 % 10 = 2
So 151155-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O2/c10-6-8-3-1-2-7-4-5-11-9(7)8/h1-3,10H,4-6H2
