15178-48-0 Usage
Description
2-Fluoro-4-Mercapto-Aniline is a chemical compound with the molecular formula C6H6FN and a molecular weight of 125.12 g/mol. It is a derivative of aniline, characterized by the presence of a fluorine atom and a thiol (sulfhydryl) group attached to the benzene ring. 2-Fluoro-4-Mercapto-Aniline is known for its potential applications in various industries, particularly due to its ability to interact with biological systems.
Uses
Used in Organic Synthesis:
2-Fluoro-4-Mercapto-Aniline is used as a key intermediate in organic synthesis for the production of various chemical products. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Fluoro-4-Mercapto-Aniline is used as an intermediate for the development of new drugs. Its ability to interact with biological systems makes it a promising candidate for the creation of pharmaceuticals with specific therapeutic properties.
Used in Dye Production:
2-Fluoro-4-Mercapto-Aniline is also utilized in the production of dyes due to its chemical properties. Its presence in dye molecules can impart unique color characteristics and improve the dye's performance in various applications.
Safety Precautions:
It is crucial to handle 2-Fluoro-4-Mercapto-Aniline with caution, as it is classified as a hazardous substance. Exposure to skin and eyes can cause irritation, and ingestion or inhalation may lead to harmful health effects. Proper safety measures, including the use of personal protective equipment and adherence to safety guidelines, should be followed during its handling and processing.
Check Digit Verification of cas no
The CAS Registry Mumber 15178-48-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,7 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15178-48:
(7*1)+(6*5)+(5*1)+(4*7)+(3*8)+(2*4)+(1*8)=110
110 % 10 = 0
So 15178-48-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6FNS/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2