153181-43-2 Usage
Description
(4R,5S,6S,7R)-4,7-dibenzyl-1,3-diethyl-5,6-dihydroxy-1,3-diazepan-2-on e is a complex organic compound with a diazepane ring structure, featuring two benzyl groups and two ethyl groups attached to the diazepane ring, as well as two hydroxyl groups at positions 5 and 6 of the ring. Its complex structure and the presence of hydroxyl groups suggest potential biological activity, which could involve chemical reactions and interactions with biological systems. Further research is required to ascertain its specific properties and possible applications.
Uses
1. Used in Pharmaceutical Applications:
(4R,5S,6S,7R)-4,7-dibenzyl-1,3-diethyl-5,6-dihydroxy-1,3-diazepan-2-on e, due to its complex structure and hydroxyl groups, may be used as a pharmaceutical candidate for various therapeutic applications. Its potential use could be attributed to its ability to interact with biological systems, possibly through hydrogen bonding or other interactions facilitated by the hydroxyl groups.
2. Used in Chemical Research:
As a complex organic molecule, (4R,5S,6S,7R)-4,7-dibenzyl-1,3-diethyl-5,6-dihydroxy-1,3-diazepan-2-on e could be utilized in chemical research for studying its reactivity, stability, and potential to form new compounds through various chemical reactions. The presence of the diazepane ring and multiple functional groups may offer unique opportunities for synthetic chemistry and the development of novel molecules with specific properties.
3. Used in Drug Delivery Systems:
Similar to other complex organic compounds with potential biological activity, (4R,5S,6S,7R)-4,7-dibenzyl-1,3-diethyl-5,6-dihydroxy-1,3-diazepan-2-on e could be explored for its use in drug delivery systems. The hydroxyl groups may allow for the compound to be modified or conjugated to other molecules, potentially enhancing its delivery to target sites within the body and improving its overall therapeutic efficacy.
4. Used in Material Science:
The unique structural features of (4R,5S,6S,7R)-4,7-dibenzyl-1,3-diethyl-5,6-dihydroxy-1,3-diazepan-2-on e may also find applications in material science, where its properties could be harnessed to create new materials with specific characteristics, such as improved stability, reactivity, or biocompatibility.
Check Digit Verification of cas no
The CAS Registry Mumber 153181-43-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,1,8 and 1 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 153181-43:
(8*1)+(7*5)+(6*3)+(5*1)+(4*8)+(3*1)+(2*4)+(1*3)=112
112 % 10 = 2
So 153181-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H30N2O3/c1-3-24-19(15-17-11-7-5-8-12-17)21(26)22(27)20(25(4-2)23(24)28)16-18-13-9-6-10-14-18/h5-14,19-22,26-27H,3-4,15-16H2,1-2H3/t19-,20-,21+,22+/m1/s1
153181-43-2Relevant articles and documents
Cyclic HIV protease inhibitors: Synthesis, conformational analysis, P2/P2' structure-activity relationship, and molecular recognition of cyclic ureas
Lam, Patrick Y. S.,Ru, Yu,Jadhav, Prabhakar K.,Aldrich, Paul E.,DeLucca, George V.,Eyermann, Charles J.,Chang, Chong-Hwan,Emmett, George,Holler, Edward R.,Daneker, Wayne F.,Li, Liangzhu,Confalone, Pat N.,McHugh, Robert J.,Han, Qi,Li, Renhua,Markwalder, Jay A.,Seitz, Steven P.,Sharpe, Thomas R.,Bacheler, Lee T.,Rayner, Marlene M.,Klabe, Ronald M.,Shum, Linyee,Winslow, Dean L.,Kornhauser, David M.,Jackson, David A.,Erickson-Viitanen, Susan,Hodge, C. Nicholas
, p. 3514 - 3525 (2007/10/03)
High-resolution X-ray structures of the complexes of HIV-1 protease (HIV-1PR) with peptidomimetic inhibitors reveal the presence of a structural water molecule which is hydrogen bonded to both the mobile flaps of the enzyme and the two carbonyls flanking