153458-34-5 Usage
Uses
Used in Organic Synthesis:
5-Isoxazolamine,3-ethyl-4-methyl-(9CI) is utilized as a key intermediate in organic synthesis for the creation of various chemical compounds. Its unique structure allows for versatile reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-Isoxazolamine,3-ethyl-4-methyl-(9CI) serves as a precursor in the development of new drugs. Its properties can be harnessed to design and synthesize pharmaceutical agents with potential therapeutic applications.
Used in the Study of Biological Processes:
5-Isoxazolamine,3-ethyl-4-methyl-(9CI) is also employed in biological research to investigate various biological processes. Its interaction with biological systems can provide insights into the mechanisms of action and potential applications in medicine and biology.
The specific applications and uses of 5-Isoxazolamine,3-ethyl-4-methyl-(9CI) may vary depending on the research and development needs, highlighting its adaptability and importance in the fields of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 153458-34-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,4,5 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 153458-34:
(8*1)+(7*5)+(6*3)+(5*4)+(4*5)+(3*8)+(2*3)+(1*4)=135
135 % 10 = 5
So 153458-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2O/c1-3-5-4(2)6(7)9-8-5/h3,7H2,1-2H3
