154012-16-5 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 5-amino-4,6-dichloronicotinate is used as an intermediate in organic synthesis for the preparation of various pharmaceuticals. Its unique structural properties and functional groups contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical field, Ethyl 5-amino-4,6-dichloronicotinate serves as an intermediate for the synthesis of various agrochemicals. Its chemical structure allows for the creation of compounds that can be used in pest control and crop protection, enhancing agricultural productivity and sustainability.
Used in Drug Discovery Research:
Ethyl 5-amino-4,6-dichloronicotinate is utilized in drug discovery research due to its potential biological activity. Researchers explore its interactions with biological targets to identify new therapeutic agents or optimize existing ones, contributing to the advancement of medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 154012-16-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,4,0,1 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 154012-16:
(8*1)+(7*5)+(6*4)+(5*0)+(4*1)+(3*2)+(2*1)+(1*6)=85
85 % 10 = 5
So 154012-16-5 is a valid CAS Registry Number.
InChI:InChI:1S/C8H8Cl2N2O2/c1-2-14-8(13)4-3-12-7(10)6(11)5(4)9/h3H,2,11H2,1H3
