155789-92-7

Usage

Uses

Used in Pharmaceutical Industry:
3-Methoxy-2-Nitro-4-Picoline is used as a synthetic intermediate for the preparation of various biological compounds, particularly non-nucleoside inhibitors of HIV-1 reverse transcriptase. Its application in this field is due to its ability to inhibit the replication of the HIV virus, thus playing a crucial role in the development of antiretroviral drugs.
Used in Synthetic Chemistry:
3-Methoxy-2-Nitro-4-Picoline is also used as a building block in the synthesis of other complex organic molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure allows for further functionalization and modification, making it a valuable component in the development of new and innovative compounds with diverse applications.

InChI:InChI=1/C7H8N2O3/c1-5-3-4-8-7(9(10)11)6(5)12-2/h3-4H,1-2H3

Upstream product

• 15128-89-9 2-nitro-3-hydroxy-4-methylpyridine 
• 74-88-4 methyl iodide 
• 1121-19-3 4-methylpyridin-3-ol 

Downstream Products

• 155789-82-5 2-amino-1,7-dimethylimidazo<4,5-b>pyridine 
• 155790-05-9 4,N³-Dimethyl-pyridine-2,3-diamine 

Relevant academic research and scientific papers

Drug efflux pump inhibitor

A medicament for preventive and/or therapeutic treatment of a microbial infection which comprises as an active ingredient a compound represented by the following general formula (I): wherein, R1 and R2 represent hydrogen atom, a halogen atom, hydroxyl group or the like, W1 represents —CH═CH—, —CH2O—, —CH2CH2— or the like; R3 represents hydrogen atom, a halogen atom, hydroxyl group or an amino group; R4 represents hydrogen atom, a group of —OZ0-4R5 (Z0-4 represents an alkylene group, a fluorine-substituted alkylene group or a single bond, and R5 represents a cyclic alkyl group, an aryl group or the like); W2 represents a single bond or —C(R8)═C(R9)— (R8 and R9 represent hydrogen atom, a halogen atom, a lower alkyl group or the like, Q represents an acidic group, but W2 and Q may together form vinylidenethiazolidinedione or an equivalent heterocyclic ring; m and n represent an integer of 0 to 2, and q represents an integer of 0 to 3.

SYNTHESIS OF THE MUTAGENIC 2-AMINO-1,6-DIMETHYLIMIDAZOPYRIDINE (1,6-DMIP) AND FIVE OF ITS ISOMERS

Synthetic routes to 2-amino-1,6-dimethylimidazopyridine and its 1,5-, 1,7-, 3,5- 3,6- and 3,7-dimethyl isomers from methyl derivatives of 3-hydroxy- or 2-amino-pyridine and 2-chloronicotinic acid are described.