157738-48-2 Usage
Uses
1. Used in Organic Synthesis:
1-[4-(2-Chloroethoxy)phenyl]-2-(ethyl-d5)-2-phenylethanone is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows it to be a valuable building block for creating a wide range of molecules with different applications in various industries.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-[4-(2-Chloroethoxy)phenyl]-2-(ethyl-d5)-2-phenylethanone is used as a key component in the development of new drugs. Its chemical properties make it suitable for the synthesis of various drug candidates, potentially leading to the discovery of novel therapeutic agents.
3. Used in Chemical Research:
1-[4-(2-Chloroethoxy)phenyl]-2-(ethyl-d5)-2-phenylethanone is also utilized in chemical research for studying the properties and reactivity of similar compounds. Its unique structure provides valuable insights into the behavior of related molecules, contributing to the advancement of chemical knowledge.
4. Used in Material Science:
In the field of material science, 1-[4-(2-Chloroethoxy)phenyl]-2-(ethyl-d5)-2-phenylethanone can be used to develop new materials with specific properties. Its incorporation into polymers or other materials may result in novel applications, such as improved conductivity, enhanced stability, or unique optical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 157738-48-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,7,3 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 157738-48:
(8*1)+(7*5)+(6*7)+(5*7)+(4*3)+(3*8)+(2*4)+(1*8)=172
172 % 10 = 2
So 157738-48-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H19ClO2/c1-2-17(14-6-4-3-5-7-14)18(20)15-8-10-16(11-9-15)21-13-12-19/h3-11,17H,2,12-13H2,1H3/i1D3,2D2
157738-48-2Relevant academic research and scientific papers
Synthesis of -tamoxifen; A Mechanistic Probe of Tamoxifen Induced Hepatic DNA Adduct Formation
Horton, Martin N.,Jarman, Michael,Potter, Gerard A.
, p. 767 - 772 (2007/10/02)
Tamoxifen which incorporates a fully deuterated ethyl group, 5-ethyl>-tamoxifen, has been synthesised in order to probe the mechanism of tamoxifen induced hepatic DNA adduct formation.The pentadeuteroethyl group was introduced into the tamoxi