1580-05-8 Usage
Uses
Used in Organic Synthesis:
2-Bromo-4-fluoro-1,3,5-trimethylbenzene is used as a building block in organic synthesis for the production of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure allows for versatile reactions and modifications, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Bromo-4-fluoro-1,3,5-trimethylbenzene is used as a key intermediate in the synthesis of various drug molecules. Its presence in the molecular structure can impart specific biological activities and properties, contributing to the development of novel therapeutic agents.
Used in Agrochemical Industry:
2-Bromo-4-fluoro-1,3,5-trimethylbenzene is also utilized in the agrochemical industry as a precursor for the synthesis of pesticides and other agrochemical products. Its incorporation into these compounds can enhance their effectiveness and selectivity, leading to improved crop protection.
Used as a Reagent in Synthesis:
2-Bromo-4-fluoro-1,3,5-trimethylbenzene serves as a reagent in the synthesis of other organic compounds. Its reactive bromine and fluorine atoms facilitate various chemical reactions, making it a useful tool in the preparation of a wide range of organic molecules.
Used in Research and Development:
In the fields of medicinal chemistry and material science, 2-Bromo-4-fluoro-1,3,5-trimethylbenzene is employed in research and development. Its unique properties and potential applications make it an interesting subject for scientific exploration and innovation.
Safety Precautions:
When handling and using 2-Bromo-4-fluoro-1,3,5-trimethylbenzene, it is essential to take appropriate safety precautions due to its potential hazards. Proper handling, storage, and disposal methods should be followed to minimize risks and ensure the safety of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 1580-05-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,8 and 0 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1580-05:
(6*1)+(5*5)+(4*8)+(3*0)+(2*0)+(1*5)=68
68 % 10 = 8
So 1580-05-8 is a valid CAS Registry Number.
InChI:InChI=1S/C9H10BrF/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3
