319-91-5 Usage
General Description
2,3,4,6-TetraMethyl-1-fluorobenzene is a chemical compound with the molecular formula C10H11F. It is a colorless liquid with a molecular weight of 146.19 g/mol. The compound is mainly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It has a boiling point of 158-160°C and a flash point of 56°C. 2,3,4,6-TetraMethyl-1-fluorobenzene is also known for its strong aromatic scent and is used as a fragrance ingredient in various products. Additionally, it is considered to be a potential environmental pollutant and is subject to regulation in some jurisdictions.
Check Digit Verification of cas no
The CAS Registry Mumber 319-91-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,1 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 319-91:
(5*3)+(4*1)+(3*9)+(2*9)+(1*1)=65
65 % 10 = 5
So 319-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H13F/c1-6-5-7(2)10(11)9(4)8(6)3/h5H,1-4H3
