15813-08-8 Usage
Uses
Used in Pharmaceutical Synthesis:
4-Methyl-5-bromoimidazole is utilized as a key intermediate in the development of various pharmaceuticals. Its specific chemical structure allows it to participate in a range of reactions, facilitating the creation of new drug molecules with potential therapeutic applications.
Used in Organic Synthesis:
4-Methyl-5-bromoimidazole serves as a valuable building block in organic synthesis, contributing to the formation of a wide array of organic compounds. Its reactivity and properties make it suitable for use in various chemical reactions, broadening its applications in the synthesis of complex organic molecules.
Used in Agricultural Chemicals:
4-Methyl-5-bromoimidazole is employed as a precursor in the synthesis of agricultural chemicals, such as pesticides and herbicides. Its unique structure and reactivity enable the development of effective compounds for crop protection and management.
Used as a Precursor in Drug Synthesis:
4-Methyl-5-bromoimidazole is recognized for its role as a precursor in the synthesis of various bioactive compounds and drugs. Its presence in the chemical structure of these compounds can influence their pharmacological properties, making it an important component in drug discovery and development processes.
Check Digit Verification of cas no
The CAS Registry Mumber 15813-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,1 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15813-08:
(7*1)+(6*5)+(5*8)+(4*1)+(3*3)+(2*0)+(1*8)=98
98 % 10 = 8
So 15813-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H5BrN2/c1-3-4(5)7-2-6-3/h2H,1H3,(H,6,7)
