15862-86-9 Usage
Uses
Used in Pharmaceutical Synthesis:
2-carboxypiperidinium chloride is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the formation of complex organic molecules. Its reactivity and solubility properties make it a valuable component in the development of new drugs.
Used in Agrochemical Production:
In the agrochemical industry, 2-carboxypiperidinium chloride is utilized as an intermediate in the production of various agrochemicals, including pesticides and herbicides. Its role in these applications is to facilitate the creation of compounds that can effectively control or eliminate unwanted plant species or pests.
Used in Organic Compound Synthesis:
Beyond its applications in pharmaceuticals and agrochemicals, 2-carboxypiperidinium chloride is also used in the synthesis of other organic compounds. Its versatility allows it to be incorporated into a wide range of chemical structures, contributing to the development of new materials and substances with various applications.
While 2-carboxypiperidinium chloride is known to have some biological activity, its specific uses in this area are not well-documented. However, its potential in biological applications could be explored further, given its role as a building block in the synthesis of compounds that may have therapeutic or other biological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 15862-86-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,6 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 15862-86:
(7*1)+(6*5)+(5*8)+(4*6)+(3*2)+(2*8)+(1*6)=129
129 % 10 = 9
So 15862-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2.ClH/c8-6(9)5-3-1-2-4-7-5;/h5,7H,1-4H2,(H,8,9);1H
