159143-14-3 Usage
Main properties
1. Chemical compound
2. Contains a benzene ring
3. Contains a carboxylic acid group
4. Contains an amino acid group
5. Used in the pharmaceutical industry
6. Potential therapeutic effects
7. Used as a research tool in biochemistry and cell biology
Specific content
4-(2-amino-2-oxoethoxy)benzoic acid is a chemical compound that contains a benzene ring with a carboxylic acid group and an amino acid group attached to it.
It is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and compounds.
This chemical has potential therapeutic effects as it is being studied for its anti-inflammatory and anti-cancer properties.
It is also used as a research tool in biochemistry and cell biology due to its ability to modulate cellular processes.
The compound has a wide range of potential applications in the medical and pharmaceutical fields and is the subject of ongoing research.
Check Digit Verification of cas no
The CAS Registry Mumber 159143-14-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,1,4 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 159143-14:
(8*1)+(7*5)+(6*9)+(5*1)+(4*4)+(3*3)+(2*1)+(1*4)=133
133 % 10 = 3
So 159143-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO4/c10-8(11)5-14-7-3-1-6(2-4-7)9(12)13/h1-4H,5H2,(H2,10,11)(H,12,13)