159610-82-9 Usage
Description
FMOC-L-STYRYLALANINE, also known as N-(9-fluorenylmethoxycarbonyl)-L-styrylalanine, is a synthetic amino acid derivative that plays a crucial role in the field of peptide chemistry. It is characterized by its white to light grey powder form and is widely utilized in the synthesis of various peptides with diverse applications.
Uses
Used in Pharmaceutical Industry:
FMOC-L-STYRYLALANINE is used as a reactant for the preparation of peptides with antiangiogenic activity. These peptides have the potential to inhibit the formation of new blood vessels, which is a critical process in the growth and metastasis of cancerous tumors. By disrupting angiogenesis, these peptides can help in the development of novel therapeutic strategies against various types of cancer.
Additionally, FMOC-L-STYRYLALANINE can be employed in the synthesis of other bioactive peptides with potential applications in various therapeutic areas, such as inflammation, pain management, and central nervous system disorders. Its unique chemical properties make it a valuable building block for the development of innovative peptide-based drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 159610-82-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,6,1 and 0 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 159610-82:
(8*1)+(7*5)+(6*9)+(5*6)+(4*1)+(3*0)+(2*8)+(1*2)=149
149 % 10 = 9
So 159610-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H23NO4/c28-25(29)24(16-8-11-18-9-2-1-3-10-18)27-26(30)31-17-23-21-14-6-4-12-19(21)20-13-5-7-15-22(20)23/h1-15,23-24H,16-17H2,(H,27,30)(H,28,29)/p-1/b11-8+/t24-/m0/s1
159610-82-9Relevant articles and documents
Single chain peptide compounds having hemoregulatory activity
-
, (2008/06/13)
There is disclosed single chain peptide compounds, substituted at a Cα-atom of a non-terminal amino acid by a group--A which is defined in claim 1. The native α-side chain of the Cα atom bonded group to group --A absent. The peptide derivatives according