16108-03-5 Usage
General Description
N-Formyl-DL-Tryptophan is a synthetic derivative of the essential amino acid tryptophan. It is a complex organic compound that contains two functional groups, an amide and a carboxyl group, attached to a benzene ring. This chemical compound plays a significant role in various bio-chemical processes, and it can potentially be used in the pharmaceutical industry due to its medicinal properties, especially in the development of anti-depressants and sleep aid medications as it is linked to the production of serotonin, a neurotransmitter responsible for regulating mood and sleep patterns. However, detailed research about its mode of action, pharmacokinetics and potential side effects is still required.
Check Digit Verification of cas no
The CAS Registry Mumber 16108-03-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,1,0 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 16108-03:
(7*1)+(6*6)+(5*1)+(4*0)+(3*8)+(2*0)+(1*3)=75
75 % 10 = 5
So 16108-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O3/c15-7-14-11(12(16)17)5-8-6-13-10-4-2-1-3-9(8)10/h1-4,6-7,11,13H,5H2,(H,14,15)(H,16,17)
