16170-76-6 Usage
Uses
Used in Pharmaceutical Industry:
Bromebric acid is used as a reactant for the preparation of antitumor agents, specifically due to its antineoplastic activity. This activity allows it to contribute to the development of medications that target and combat cancer cells.
Additionally, bromebric acid may be employed in other industries where its antineoplastic properties can be leveraged for specific applications, such as in the development of targeted drug delivery systems or as a component in the synthesis of novel cancer-fighting compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 16170-76-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,1,7 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16170-76:
(7*1)+(6*6)+(5*1)+(4*7)+(3*0)+(2*7)+(1*6)=96
96 % 10 = 6
So 16170-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrO4/c1-16-8-4-2-7(3-5-8)11(15)9(12)6-10(13)14/h2-6H,1H3,(H,13,14)/b9-6+
16170-76-6Relevant academic research and scientific papers
Pyridazines. XV. Synthesis of 6-aryl-5-amino-3(2H)-pyridazinones as potential platelet aggregation inhibitors
Estevez, Isabel,Ravina, Enrique,Sotelo, Eddy
, p. 1421 - 1428 (2007/10/03)
Several 3(2H)-pyridazinones with amino groups at the 5-position of the pyridazine nucleus have been prepared. The 6-aryl-5-halo-3(2H)-pyridazinones obtained from mucochloric and mucobromic acid lead to the corresponding 5- alkylamino-3(2H)-pyridazinones,
