161836-12-0 Usage
Description
7-Bromo-1,3-dihydro-imidazo[4,5-c]pyridin-2-one is a heterocyclic chemical compound characterized by a molecular formula of C7H6BrN3O. It features a unique fused imidazopyridine ring system, which endows it with diverse biological activities and makes it a promising candidate in the fields of medicinal chemistry and drug discovery.
Uses
Used in Medicinal Chemistry:
7-Bromo-1,3-dihydro-imidazo[4,5-c]pyridin-2-one is utilized as a kinase inhibitor, playing a crucial role in the regulation of various cellular processes. Its ability to inhibit kinase activity contributes to its potential as a therapeutic agent for the treatment of diseases associated with abnormal kinase function.
Used in Drug Discovery:
As a compound with diverse biological activities, 7-Bromo-1,3-dihydro-imidazo[4,5-c]pyridin-2-one serves as a valuable starting point for the development of new drugs. Its unique chemical structure allows for the design and synthesis of novel compounds with potential therapeutic applications.
Used in Organic Synthesis:
7-Bromo-1,3-dihydro-imidazo[4,5-c]pyridin-2-one is also of interest to researchers for its potential role in the synthesis of other complex organic compounds. Its structural features make it a versatile building block for the creation of new compounds with potential pharmaceutical or industrial applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 7-Bromo-1,3-dihydro-imidazo[4,5-c]pyridin-2-one is used as a key intermediate in the synthesis of various drug candidates. Its unique properties and potential biological activities make it a valuable component in the development of innovative therapeutic agents.
Used in Chemical Research:
7-Bromo-1,3-dihydro-imidazo[4,5-c]pyridin-2-one is employed as a research tool in chemical laboratories, where it is used to study the structure-activity relationships of heterocyclic compounds and to explore new synthetic routes for the preparation of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 161836-12-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,8,3 and 6 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 161836-12:
(8*1)+(7*6)+(6*1)+(5*8)+(4*3)+(3*6)+(2*1)+(1*2)=130
130 % 10 = 0
So 161836-12-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrN3O/c7-3-1-8-2-4-5(3)10-6(11)9-4/h1-2H,(H2,9,10,11)
161836-12-0Relevant articles and documents
SYNTHESIS AND PROPERTIES OF 4-HALOIMIDAZOPYRIDIN-2-ONES
Yutilov, Yu.M.,Svertilova, I.A.
, p. 923 - 927 (1994)
The nitro group in 4-nitroimidazopyridin-2-ones is rather labile and may be reploaced upon heating with hydrohalic acids to give the corresponding 4-halides.A methyl group at N(3) leads to a sharp increase in the lability of the nitro gr
