161949-50-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-5-iodoanisole is used as a reagent in organic synthesis for the preparation of various pharmaceuticals. Its ability to undergo nucleophilic aromatic substitution reactions allows for the creation of new compounds with potential medicinal properties, contributing to the development of innovative treatments and therapies.
Used in Agrochemical Industry:
In the agrochemical sector, 2-chloro-5-iodoanisole serves as a crucial intermediate in the synthesis of compounds used in agricultural chemicals. Its unique reactivity aids in the production of substances that can be employed for pest control, crop protection, and other agricultural applications, enhancing crop yields and ensuring food security.
Used in Organic Chemistry Research:
2-Chloro-5-iodoanisole is utilized as a key building block in organic chemistry research, where its synthetic utility is explored for the creation of new chemical entities. Researchers leverage its reactivity to investigate novel reaction pathways and mechanisms, thereby expanding the scope of organic synthesis and contributing to the discovery of new chemical compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 161949-50-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,9,4 and 9 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 161949-50:
(8*1)+(7*6)+(6*1)+(5*9)+(4*4)+(3*9)+(2*5)+(1*0)=154
154 % 10 = 4
So 161949-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClIO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,1H3
161949-50-4Relevant academic research and scientific papers
Coleman, Robert S.,Lu, Xiaoling
, p. 423 - 425 (2006)
An efficient, six-step stereocontrolled total synthesis of the antifungal agent strobilurin B is reported and was based on a convergent bi-directional coupling featuring a hetero-bis-1,4-metallated pentadiene system as the linchpin. The Royal Society of C
