16290-26-9 Usage
Uses
Used in Pharmaceutical Industry:
3,4-Dihydroxybenzylamine hydrobromide is used as a reactant for the synthesis of capsaicin soft drugs, which are designed to target the transient receptor potential vanilloid 1 channel (TRPV1). This application is particularly relevant in the development of pain relief medications and other therapeutic agents that modulate the TRPV1 channel for various medical conditions.
Used in Chemical Synthesis:
As a light beige crystalline powder, 3,4-dihydroxybenzylamine hydrobromide can be utilized in various chemical synthesis processes due to its unique chemical properties. Its reactivity and structural features make it a valuable compound for creating new molecules and materials in the fields of organic chemistry, materials science, and pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 16290-26-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,9 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16290-26:
(7*1)+(6*6)+(5*2)+(4*9)+(3*0)+(2*2)+(1*6)=99
99 % 10 = 9
So 16290-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2.BrH/c8-4-5-1-2-6(9)7(10)3-5;/h1-3,9-10H,4,8H2;1H
