162960-26-1 Usage
Uses
Used in Pharmaceutical Drug Development:
1-(Pyridin-2-yl)cyclopropanecarboxylic acid is used as a potential active pharmaceutical ingredient for the development of new drugs. Its unique structure and potential medicinal properties make it a valuable compound for exploring novel therapeutic agents.
Used in Organic Synthesis:
1-(Pyridin-2-yl)cyclopropanecarboxylic acid serves as a building block for the synthesis of other organic compounds. Its versatile structure allows for further chemical modifications and functionalization, enabling the creation of new molecules with potential applications in various industries.
Used in Medicinal Chemistry Research:
1-(Pyridin-2-yl)cyclopropanecarboxylic acid is utilized as a research tool in medicinal chemistry to study its pharmacological activities and explore its potential as a therapeutic agent. Researchers investigate its interactions with biological targets and evaluate its efficacy and safety in treating various diseases.
Used in Drug Discovery:
1-(Pyridin-2-yl)cyclopropanecarboxylic acid plays a crucial role in drug discovery, where it is assessed for its potential to become a new drug candidate. Its unique properties and structure make it an attractive compound for high-throughput screening and optimization processes in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 162960-26-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,2,9,6 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 162960-26:
(8*1)+(7*6)+(6*2)+(5*9)+(4*6)+(3*0)+(2*2)+(1*6)=141
141 % 10 = 1
So 162960-26-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO2/c11-8(12)9(4-5-9)7-3-1-2-6-10-7/h1-3,6H,4-5H2,(H,11,12)
162960-26-1Relevant articles and documents
COMPOUNDS FOR TREATING VIRAL INFECTIONS
-
Page/Page column 80; 87, (2008/12/08)
The invention relates to compounds, pharmaceutical compositions and methods useful for treating viral infection.
Therapeutic agents
-
, (2008/06/13)
Tetrahydroisoquinoline compounds of formula I STR1 and pharmaceutically acceptable salts thereof, in which: R1 represents one or more substituents selected from H, halo, hydroxy, alkyl (optionally substituted by hydroxy), alkoxy, alkylthio, alk