16418-56-7 Usage
General Description
2-Phenyl-2,3-diazaspiro[4.5]decane-1,4-dione is a chemical compound with a unique molecular structure that contains a spirocyclic ring system. It is a heterocyclic compound that contains both nitrogen and carbon atoms in its ring structure. 2-Phenyl-2,3-diazaspiro[4.5]decane-1,4-dione has potential applications in medicinal chemistry as it exhibits interesting biological activities. Its spirocyclic structure provides it with unique properties that make it of interest for potential pharmaceutical development. Furthermore, its molecular structure makes it a valuable building block in organic synthesis for the creation of novel compounds with potential pharmacological and biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 16418-56-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,1 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16418-56:
(7*1)+(6*6)+(5*4)+(4*1)+(3*8)+(2*5)+(1*6)=107
107 % 10 = 7
So 16418-56-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N2O2/c17-12-14(9-5-2-6-10-14)13(18)16(15-12)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,17)
