16467-50-8 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-Chloro-acetyl)-3-cyclohexyl-urea is used as an intermediate in the synthesis of pharmaceutical compounds for various therapeutic applications. Its unique structure and reactive functional groups enable the development of new drugs with potential medicinal properties.
Used in Chemical Synthesis:
In the chemical industry, 1-(2-Chloro-acetyl)-3-cyclohexyl-urea serves as a key intermediate in the synthesis of various organic compounds. Its presence of chloro and acetyl groups allows for further reactions and modifications, leading to the creation of new molecules with specific properties and applications.
Used in Research and Development:
1-(2-Chloro-acetyl)-3-cyclohexyl-urea is utilized in research and development laboratories for studying its chemical properties, reactivity, and potential applications in various fields. Its unique structure and functional groups make it an interesting subject for scientific exploration and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 16467-50-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,6 and 7 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 16467-50:
(7*1)+(6*6)+(5*4)+(4*6)+(3*7)+(2*5)+(1*0)=118
118 % 10 = 8
So 16467-50-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H15ClN2O2/c10-6-8(13)12-9(14)11-7-4-2-1-3-5-7/h7H,1-6H2,(H2,11,12,13,14)
