1655-49-8 Usage
General Description
Di-DNP-L-Lysine, also known as bis(2,4-dinitrophenyl)-L-lysine, is a chemical compound that belongs to the class of organic compounds called L-alpha-amino acids. It is used as a reagent in biochemical research, particularly in studies related to protein synthesis and degradation. DI-DNP-L-LYSINE can be identified by its molecular formula, C18H23N5O10, and its distinct yellow appearance. Being a lysine derivative, Di-DNP-L-Lysine plays a crucial role in various biological functions. However, the specific properties and potential hazards of this chemical are not widely documented, necessitating careful handling and use in scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1655-49-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,5 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1655-49:
(6*1)+(5*6)+(4*5)+(3*5)+(2*4)+(1*9)=88
88 % 10 = 8
So 1655-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H18N6O10/c25-18(26)15(20-14-7-5-12(22(29)30)10-17(14)24(33)34)3-1-2-8-19-13-6-4-11(21(27)28)9-16(13)23(31)32/h4-7,9-10,15,19-20H,1-3,8H2,(H,25,26)