1670-89-9 Usage
Description
1H-Indole-7-carboxamide(9CI), also known as 9CI, is a chemical compound belonging to the indole derivative family. It possesses a chemical formula of C9H8N2O and a molecular weight of 160.17g/mol. Indole derivatives such as 9CI are widely utilized in chemical and pharmaceutical research due to their bioactive properties. They serve as valuable synthetic intermediates for the production of various biologically active compounds, making them essential in drug discovery, medicinal chemistry, and organic synthesis.
Uses
Used in Pharmaceutical Research:
1H-Indole-7-carboxamide(9CI) is used as a synthetic intermediate for the development of biologically active compounds. Its bioactive properties make it a promising candidate in drug discovery and medicinal chemistry, contributing to the creation of novel therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 1H-Indole-7-carboxamide(9CI) is employed as a key building block for the synthesis of complex organic molecules. Its versatile chemical structure allows for the formation of a wide range of biologically relevant compounds, enhancing the scope of chemical research and development.
Used in Chemical Research:
1H-Indole-7-carboxamide(9CI) is utilized as a research tool in various chemical studies. Its unique properties and reactivity enable scientists to explore new reaction pathways and mechanisms, furthering our understanding of chemical processes and potentially leading to the discovery of new chemical entities with practical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1670-89-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,7 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1670-89:
(6*1)+(5*6)+(4*7)+(3*0)+(2*8)+(1*9)=89
89 % 10 = 9
So 1670-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O/c10-9(12)7-3-1-2-6-4-5-11-8(6)7/h1-5,11H,(H2,10,12)
1670-89-9Relevant articles and documents
Some Observations on the Formation of 1-Hydroxyindoles in the Leimgruber-Batcho Indole Synthesis
Clark, Robin D.,Repke, David B.
, p. 121 - 125 (2007/10/02)
The factors influencing the formation of 1-hydroxyindoles in the catalytic hydrogenation of β-dimethylamino-2-nitrostyrenes (Leimgruber-Batcho indole synthesis) have been investigated.Significant amounts of 1-hydroxyindoles were obtained only when the β-dimethylamino-2-nitrostyrene was substituted with an electron-withdrawing group at the 5 or 6 position.The proportion of 1-hydroxyindole formed relative to the normal indole product was found to increase as both the amount of catalyst and hydrogen pressure were decreased.
