1681-96-5 Usage
Uses
Used in Pharmaceutical Industry:
N-formyl-L-glutamic acid is used as a building block for the synthesis of peptides and proteins, playing a crucial role in the development of new pharmaceutical compounds.
Used in Therapeutic Applications:
N-formyl-L-glutamic acid is used as a potential treatment for inflammation and neurological disorders, due to its inherent biological activity and potential to modulate various physiological pathways.
Used in Antibiotic Production:
N-formyl-L-glutamic acid is used as a precursor in the production of certain antibiotics, contributing to the development of new antimicrobial agents.
Used in Research and Development:
N-formyl-L-glutamic acid is utilized in research settings to explore its potential applications and mechanisms of action, further expanding its use in the medical and pharmaceutical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 1681-96-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,8 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1681-96:
(6*1)+(5*6)+(4*8)+(3*1)+(2*9)+(1*6)=95
95 % 10 = 5
So 1681-96-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-2/t4-/m0/s1
