16849-69-7 Usage
Uses
Used in Polymer Synthesis:
2,6-dimethoxyterephthalic acid is used as a monomer in the synthesis of polyesters and polyamides. Its chemical structure allows for the creation of polymers with specific properties, such as improved thermal stability and mechanical strength.
Used in Liquid Crystal Production:
In the display industry, 2,6-dimethoxyterephthalic acid is used as a building block in the production of liquid crystals. Its incorporation into liquid crystal materials can lead to enhanced performance characteristics, such as better response times and improved color reproduction.
Used in Pharmaceutical Development:
2,6-dimethoxyterephthalic acid is employed as a starting material or intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure can be utilized to develop new drug candidates with potential therapeutic applications.
Used in Chemical Research:
Due to its reactivity and versatility, 2,6-dimethoxyterephthalic acid is used in academic and industrial research settings to explore new chemical reactions and syntheses, potentially leading to the discovery of novel compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 16849-69-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,8,4 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16849-69:
(7*1)+(6*6)+(5*8)+(4*4)+(3*9)+(2*6)+(1*9)=147
147 % 10 = 7
So 16849-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O6/c1-15-6-3-5(9(11)12)4-7(16-2)8(6)10(13)14/h3-4H,1-2H3,(H,11,12)(H,13,14)
