168971-56-0 Usage
Chemical compound
2-(Phenoxymethyl)benzylamine 97 is a chemical compound commonly used as an intermediate in the production of pharmaceuticals, dyes, and other organic compounds.
Physical properties
It is a clear, colorless liquid with a molecular formula of C14H15NO and a molecular weight of 213.27 g/mol.
Versatile chemical properties
2-(Phenoxymethyl)benzylamine 97 is often used as a building block for the synthesis of various pharmaceuticals and agrochemicals due to its versatile chemical properties.
Industrial uses
It can also be used as a corrosion inhibitor, surfactant, and disinfectant in the chemical industry.
Storage
2-(Phenoxymethyl)benzylamine 97 is typically stored in air-tight containers away from heat, direct sunlight, and incompatible materials to prevent degradation and ensure its purity for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 168971-56-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,8,9,7 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 168971-56:
(8*1)+(7*6)+(6*8)+(5*9)+(4*7)+(3*1)+(2*5)+(1*6)=190
190 % 10 = 0
So 168971-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO/c15-10-12-6-4-5-7-13(12)11-16-14-8-2-1-3-9-14/h1-9H,10-11,15H2
