16990-73-1 Usage
Uses
Used in Pharmaceutical Industry:
1H-Indol-2-ol is used as a key building block for the synthesis of various pharmaceuticals due to its potential pharmacological activities, including antioxidant, anti-inflammatory, and anticancer properties. Its unique structure and versatile reactivity make it suitable for the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
1H-Indol-2-ol is used as a key intermediate in the synthesis of various agrochemicals, contributing to the development of new pesticides, herbicides, and other agricultural chemicals. Its versatile reactivity allows for the creation of compounds with improved efficacy and reduced environmental impact.
Used in Materials Science:
1H-Indol-2-ol is used as a valuable chemical compound in the field of materials science, where its unique structure and properties can be utilized to develop new materials with specific characteristics. This can include the creation of advanced materials for various applications, such as sensors, catalysts, or other specialized materials.
Overall, 1H-Indol-2-ol's diverse applications across different industries highlight its importance as a versatile and valuable chemical compound with significant potential in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 16990-73-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,9 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 16990-73:
(7*1)+(6*6)+(5*9)+(4*9)+(3*0)+(2*7)+(1*3)=141
141 % 10 = 1
So 16990-73-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO/c10-8-5-6-3-1-2-4-7(6)9-8/h1-5,9-10H
16990-73-1Relevant academic research and scientific papers
Directed evolution of the fatty-acid hydroxylase P450 BM-3 into an indole-hydroxylating catalyst
Li, Qing-Shan,Schwaneberg, Ulrich,Fischer, Peter,Schmid, Rolf D.
, p. 1531 - 1536 (2007/10/03)
The self-sufficient cytochrome P450 BM-3 enzyme from Bacillus megaterium catalyzes subterminal hydroxylation of saturated long-chain fatty acids and structurally related compounds. Since the primary structure of P450 BM-3 is homologous to that of mammalian P450 type II, it represents an excellent model for this family of enzymes. During studies on the directed evolution of P450 BM-3 into a medium-chain fatty-acid hydroxylase, several mutants, in particular the triple mutant Phe87Val, Leu 188Gln, Ala74Gly, were observed to hydroxylate indole, producing indigo and indiruhin at a catalytic efficiency of 1365M-1s-1 (kcat=2.73 s-1 and Km,=2.0mM). Both products were unequivocally characterized by NMR and MS analysis. Wild-type P450 BM-3 is incapable to hydroxylate indole. These results demonstrate that an enzyme can be engineered to catalyze the transformation of substrates with structures widely divergent from those of its native substrate.
