17091-45-1 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DIMETHYL-3-BENZYL-THIAZOLIUM BROMIDE is used as a synthetic intermediate for the development of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the creation of new drugs and medicinal compounds.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-DIMETHYL-3-BENZYL-THIAZOLIUM BROMIDE is utilized as a catalyst in the synthesis of agrochemicals. Its catalytic properties facilitate the production of pesticides, herbicides, and other agricultural chemicals, enhancing their effectiveness and efficiency.
Used in Organic Synthesis:
2,4-DIMETHYL-3-BENZYL-THIAZOLIUM BROMIDE is employed as a key component in organic synthesis processes. Its versatility allows it to participate in a multitude of reactions, contributing to the formation of complex organic molecules for various applications.
Used as a Catalyst in Chemical Reactions:
2,4-DIMETHYL-3-BENZYL-THIAZOLIUM BROMIDE serves as an effective catalyst in numerous chemical reactions, accelerating the process and improving the yield of desired products. Its catalytic activity is particularly beneficial in the synthesis of complex organic and inorganic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 17091-45-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,0,9 and 1 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 17091-45:
(7*1)+(6*7)+(5*0)+(4*9)+(3*1)+(2*4)+(1*5)=101
101 % 10 = 1
So 17091-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H14NS.BrH/c1-10-9-14-11(2)13(10)8-12-6-4-3-5-7-12;/h3-7,9H,8H2,1-2H3;1H/q+1;/p-1
