170941-86-3 Usage
Uses
Used in Pharmaceutical Industry:
Butanoic acid, 2-(dimethylamino)(9CI) is used as a precursor in the production of certain drugs with psychoactive or anesthetic properties. Its unique chemical structure allows for the development of medications that can have a significant impact on the nervous system and provide relief from various conditions.
Used in Research and Development:
DAB is utilized as a building block for the synthesis of various organic compounds in research and development. Its versatile chemical properties make it a valuable component in the creation of new molecules with potential applications in various fields, including medicine, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 170941-86-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,9,4 and 1 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 170941-86:
(8*1)+(7*7)+(6*0)+(5*9)+(4*4)+(3*1)+(2*8)+(1*6)=143
143 % 10 = 3
So 170941-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2/c1-4-5(6(8)9)7(2)3/h5H,4H2,1-3H3,(H,8,9)
