17119-74-3 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-4-chloro-6-methyl-2-(methylthio)pyrimidine is utilized as a key intermediate in the synthesis of a range of pharmaceutical drugs. Its unique structure allows for the development of new therapeutic agents with potential applications in treating various diseases.
Used in Antiviral Applications:
5-BroMo-4-chloro-6-Methyl-2-(Methylthio)pyriMidine has been studied for its potential antiviral properties, making it a candidate for the development of new antiviral medications. Its ability to interact with viral components could lead to the inhibition of viral replication and spread.
Used in Anti-Cancer Applications:
5-Bromo-4-chloro-6-methyl-2-(methylthio)pyrimidine is also being investigated for its potential anti-cancer properties. Its incorporation into drug molecules could target and inhibit the growth of cancer cells, offering a new avenue for cancer treatment.
Used in Agrochemical Production:
In the agrochemical industry, 5-BroMo-4-chloro-6-Methyl-2-(Methylthio)pyriMidine serves as a building block for the development of new pesticides and other crop protection agents. Its chemical structure can be tailored to target specific pests or diseases, enhancing the effectiveness of agrochemical products.
Used in Specialty Chemicals:
5-Bromo-4-chloro-6-methyl-2-(methylthio)pyrimidine is also employed in the production of specialty chemicals, such as dyes, pigments, and other industrial chemicals. Its versatile nature allows for its use in a wide range of applications, making it a valuable compound in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 17119-74-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,1 and 9 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 17119-74:
(7*1)+(6*7)+(5*1)+(4*1)+(3*9)+(2*7)+(1*4)=103
103 % 10 = 3
So 17119-74-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BrClN2S/c1-3-4(7)5(8)10-6(9-3)11-2/h1-2H3
