171809-12-4 Usage
General Description
3-Amino-5-fluoro-1-methylindazole is a chemical compound with the molecular formula C8H7FN2. It is a derivative of indazole, a heterocyclic compound containing a five-membered ring with three carbon atoms, two nitrogen atoms, and one hydrogen atom. The compound is characterized by the presence of an amino group (NH2), a fluorine atom (F), and a methyl group (CH3) attached to the indazole ring. 3-Amino-5-fluoro-1-methylindazole is known for its potential biological and pharmaceutical applications, and it is of interest in medicinal chemistry for the development of novel therapeutic agents. Its chemical properties and structure make it a promising candidate for further research and exploration in the field of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 171809-12-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,0 and 9 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 171809-12:
(8*1)+(7*7)+(6*1)+(5*8)+(4*0)+(3*9)+(2*1)+(1*2)=134
134 % 10 = 4
So 171809-12-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FN3/c1-12-7-3-2-5(9)4-6(7)8(10)11-12/h2-4H,1H3,(H2,10,11)
171809-12-4Relevant articles and documents
A method for the regioselective synthesis of 1-alkyl-1H-indazoles
Liu, Han-Jun,Hung, Shiang-Fu,Chen, Chuan-Lin,Lin, Mei-Huey
, p. 3907 - 3912 (2013/06/27)
A method for the regioselective synthesis of 3-unsubstituted 1-alkyl-1H-indazoles, starting with 2-halobenzonitriles and N-alkylhydrazines, is described. The two-step reaction pathway proceeds through the intermediacy of 1-alkyl-3-amino-1H-indazoles follo
