171809-12-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-5-fluoro-1-methylindazole is used as a building block for the synthesis of various pharmaceutical compounds due to its unique chemical structure and properties. Its presence of an amino group, fluorine atom, and methyl group allows for versatile chemical modifications, making it a valuable intermediate in the development of new drugs with improved efficacy and selectivity.
Used in Medicinal Chemistry Research:
3-Amino-5-fluoro-1-methylindazole is used as a research tool in medicinal chemistry for the exploration of its potential as a therapeutic agent. Its indazole core and functional groups provide a foundation for studying the compound's interactions with biological targets, such as enzymes, receptors, or ion channels, which may lead to the discovery of new drugs with novel mechanisms of action.
Used in Drug Discovery and Development:
3-Amino-5-fluoro-1-methylindazole is used as a starting point for the design and optimization of new drug candidates. Its unique structure and functional groups can be exploited to create molecules with specific biological activities, such as agonists, antagonists, or modulators of target proteins. 3-AMino-5-fluoro-1-Methylindazole's potential in drug discovery and development makes it an attractive target for further research and investigation in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 171809-12-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,8,0 and 9 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 171809-12:
(8*1)+(7*7)+(6*1)+(5*8)+(4*0)+(3*9)+(2*1)+(1*2)=134
134 % 10 = 4
So 171809-12-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FN3/c1-12-7-3-2-5(9)4-6(7)8(10)11-12/h2-4H,1H3,(H2,10,11)
171809-12-4Relevant articles and documents
A method for the regioselective synthesis of 1-alkyl-1H-indazoles
Liu, Han-Jun,Hung, Shiang-Fu,Chen, Chuan-Lin,Lin, Mei-Huey
, p. 3907 - 3912 (2013/06/27)
A method for the regioselective synthesis of 3-unsubstituted 1-alkyl-1H-indazoles, starting with 2-halobenzonitriles and N-alkylhydrazines, is described. The two-step reaction pathway proceeds through the intermediacy of 1-alkyl-3-amino-1H-indazoles follo
