171916-75-9 Usage
General Description
The chemical compound "(3AS)-5-AZIDO-7-BROMO-3A 4 5 7A-TETRAHY&" is a derivative of a tetrahydropyrrolo[1,2-c]imidazole. It contains an azide group at the 5-position and a bromo group at the 7-position. The chemical structure also includes a tetrahydrofuran ring and a tetrahydrofuran-2-ylmethyl group. (3AS)-5-AZIDO-7-BROMO-3A 4 5 7A-TETRAHY& may have potential applications in organic synthesis, medicinal chemistry, or material science due to the unique combination of functional groups and the tetrahydropyrrolo[1,2-c]imidazole scaffold. The specific properties and potential uses of this compound would require further research and investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 171916-75-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,9,1 and 6 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 171916-75:
(8*1)+(7*7)+(6*1)+(5*9)+(4*1)+(3*6)+(2*7)+(1*5)=149
149 % 10 = 9
So 171916-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BrN3O3/c1-9(2)15-7-4(10)3-5(12-13-11)6(14)8(7)16-9/h3,5-8,14H,1-2H3/t5-,6+,7+,8-/m0/s1