1735-12-2 Usage
Uses
Used in Pharmaceutical Industry:
(5-Methyl-benzo(b)thiophen-3-yl)acetic acid is used as a building block for the synthesis of various pharmaceutical substances. Its unique structure and properties allow it to be a versatile component in the development of new drugs, contributing to the advancement of drug discovery and therapeutics.
Used in Organic Synthesis:
In the field of organic synthesis, (5-Methyl-benzo(b)thiophen-3-yl)acetic acid serves as a key intermediate for the creation of more complex molecules. Its distinct molecular structure facilitates the formation of novel compounds with potential applications in various industries.
Used in Materials Science:
(5-Methyl-benzo(b)thiophen-3-yl)acetic acid also has potential applications in materials science due to its unique structure and properties. It can be utilized in the development of new materials with specific characteristics, such as improved mechanical, electrical, or optical properties, which can be beneficial for various technological applications.
Overall, (5-Methyl-benzo(b)thiophen-3-yl)acetic acid is a promising compound with diverse applications in the pharmaceutical industry, organic synthesis, and materials science, showcasing its potential in drug development and other industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1735-12-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,3 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1735-12:
(6*1)+(5*7)+(4*3)+(3*5)+(2*1)+(1*2)=72
72 % 10 = 2
So 1735-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10O2S/c1-7-2-3-10-9(4-7)8(6-14-10)5-11(12)13/h2-4,6H,5H2,1H3,(H,12,13)
1735-12-2Relevant academic research and scientific papers
The Synthesis of the Monomethyl Isomers of Benzonaphththiophene
Tominaga, Yoshinori,Pratap, Ram,Castle, Raymond N.,Lee, Milton L.
, p. 859 - 863 (2007/10/02)
All isomers of the monomethylbenzonaphththiophenes were synthesized using photocyclization of 3-styrylbenzothiophenes.The 1-, 3-, 4-, and 5-methylbenzonaphthothiophenes were synthesized by irradiation of the corresponding methylated
