17386-10-6 Usage
Uses
Used in Pharmaceutical Development:
4-(PIPERIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE is used as a potential building block in the development of new pharmaceutical drugs due to its unique structure and the presence of a piperidine ring, which is a common feature in many existing medications.
Used in Organic Synthesis:
In the field of organic synthesis, 4-(PIPERIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE is utilized as a key intermediate for the synthesis of various complex organic molecules, leveraging its thiazole and piperidine components to form novel compounds with potential applications in different industries.
Used in Medicinal Chemistry Research:
4-(PIPERIDIN-1-YLMETHYL)-1,3-THIAZOL-2-AMINE serves as a subject of study in medicinal chemistry research, where its biological activities and pharmacological properties are investigated to understand its potential role in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 17386-10-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,8 and 6 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 17386-10:
(7*1)+(6*7)+(5*3)+(4*8)+(3*6)+(2*1)+(1*0)=116
116 % 10 = 6
So 17386-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H15N3S/c10-9-11-8(7-13-9)6-12-4-2-1-3-5-12/h7H,1-6H2,(H2,10,11)/p+1
