175136-61-5 Usage
Uses
Used in Research Applications:
6-CHLORO-8-(CHLOROMETHYL)-4H-1,3-BENZODIOXINE is used as a building block in the synthesis of other compounds for research purposes, contributing to the development of new chemical entities with potential applications in various fields.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, 6-CHLORO-8-(CHLOROMETHYL)-4H-1,3-BENZODIOXINE is used as a potential drug candidate due to its pharmacological properties. Its unique structure and functional groups may offer therapeutic benefits in the treatment of certain diseases or conditions.
However, it is crucial to handle this chemical with care due to its potential toxicity and environmental hazards, ensuring proper safety measures are in place during its use and disposal.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-61-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175136-61:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*6)+(1*1)=135
135 % 10 = 5
So 175136-61-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Cl2O2/c10-3-6-1-8(11)2-7-4-12-5-13-9(6)7/h1-2H,3-5H2
