175137-09-4 Usage
Uses
Used in Pharmaceutical Industry:
6-(4-Chlorophenyl)pyrimidine-2,4-diamine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its potent antibacterial properties make it a promising candidate for the development of new antibiotics to combat bacterial infections.
Used in Chemical Research:
6-(4-Chlorophenyl)pyrimidine-2,4-diamine is used as a research compound in chemical laboratories for studying its properties and potential applications in various chemical processes. Its unique structure and reactivity can provide insights into the development of new chemical reactions and methodologies.
Used in Material Science:
6-(4-Chlorophenyl)pyrimidine-2,4-diamine may be used as a component in the development of new materials with specific properties, such as in the synthesis of advanced polymers or coatings with antibacterial capabilities. Its chemical structure and reactivity can contribute to the creation of innovative materials with improved performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-09-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175137-09:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*0)+(1*9)=134
134 % 10 = 4
So 175137-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN4/c11-7-3-1-6(2-4-7)8-5-9(12)15-10(13)14-8/h1-5H,(H4,12,13,14,15)
175137-09-4Relevant academic research and scientific papers
Nenajdenko,Golubinskii,Lenkova,Shastin,Balenkova
, p. 255 - 256 (2005)
A method for the synthesis of 2,4-diamino-6-arylpyrimidines from guanidine and α-chlorocinnamonitriles was developed. The starting nitriles can be easily prepared by catalytic olefination reaction.
