175276-85-4 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-Fluorobenzylsufonyl)acetamidoxime is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique chemical structure allows it to be a key component in the development of new medications.
Used as a Chelating Agent:
2-(4-Fluorobenzylsufonyl)acetamidoxime is known for its potential as a chelating agent, which can bind to metal ions. This property has been studied for its potential use in the treatment of metal poisoning, where it can help to remove toxic metals from the body.
Used in Antimicrobial Applications:
2-(4-Fluorobenzylsufonyl)acetamidoxime has been investigated for its potential antimicrobial and antifungal properties. Its ability to inhibit the growth of certain microorganisms makes it a candidate for use in various applications, such as in the development of new antibiotics or antifungal agents.
However, it is important to note that further research is needed to fully understand the potential uses and safety of 2-(4-Fluorobenzylsufonyl)acetamidoxime. As with any new compound, thorough testing and evaluation are essential to ensure its effectiveness and safety before it can be widely adopted in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-85-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175276-85:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*8)+(1*5)=164
164 % 10 = 4
So 175276-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F2NS/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H2,10,11)
