175277-87-9 Usage
General Description
3-Fluoro-4-(methylthio)benzamide is a unique chemical compound with many uses in chemical, pharmaceutical, and scientific applications. The 3-fluoro element indicates the presence of fluorine, while the term 4-(methythio) denotes the presence of a methylthio group, which contains both sulfur and methyl elements. The benzamide portion refers to its benzene ring, another integral part of this compound's molecular structure. 3-FLUORO-4-(METHYLTHIO)BENZAMIDE's unique structure makes it an important chemical substrate in many synthetic and organic chemistry processes, including drug and pharmaceutical synthesis procedures. The physical and chemical properties of this compound like melting point, boiling point, and its structure, contribute to its suitability for such applications. Its properties and behavior would differ based on the presence of other elements or compounds and the conditions under which it is exposed or used.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-87-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175277-87:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*8)+(1*7)=169
169 % 10 = 9
So 175277-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FNS/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H2,10,11)