175277-87-9 Usage
Description
3-Fluoro-4-(methylthio)benzamide is a distinctive chemical compound characterized by the presence of a fluorine atom at the 3-position, a methylthio group at the 4-position, and a benzene ring. 3-FLUORO-4-(METHYLTHIO)BENZAMIDE is known for its versatile applications in various fields, including chemical, pharmaceutical, and scientific research. Its molecular structure, which includes a benzamide portion, plays a crucial role in its functionality and reactivity in different chemical processes.
Uses
Used in Chemical Synthesis:
3-Fluoro-4-(methylthio)benzamide is used as a chemical substrate for various synthetic and organic chemistry processes. Its unique structure allows it to be a key component in the creation of new compounds and materials.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 3-Fluoro-4-(methylthio)benzamide is employed as an intermediate in the synthesis of drugs and pharmaceutical products. Its properties, such as its melting point and boiling point, make it suitable for use in drug development and formulation.
Used in Scientific Research:
3-Fluoro-4-(methylthio)benzamide is utilized in scientific research as a compound of interest for studying its physical and chemical properties. Its behavior in different conditions and when combined with other elements or compounds can provide valuable insights into its potential applications and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-87-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175277-87:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*8)+(1*7)=169
169 % 10 = 9
So 175277-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FNS/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H2,10,11)