175589-02-3 Usage
Description
5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE is a chemical compound characterized by the molecular formula C7H5BrF2N. It is a derivative of difluorobenzene, featuring a bromine atom and an aminomethyl group attached to the benzene ring. 5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE is known for its unique structure and functional groups, which contribute to its utility in various applications.
Uses
Used in Organic Synthesis:
5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE is used as a building block in organic synthesis for the creation of various drugs and medicinal compounds. Its versatile properties and reactivity make it a valuable component in the development of new chemical entities with potential therapeutic applications.
Used in Pharmaceutical Research:
In pharmaceutical research, 5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE serves as a key intermediate in the synthesis of innovative drugs. Its unique structure allows for the exploration of new chemical pathways and the enhancement of drug efficacy and selectivity.
Used in Agrochemical Production:
5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE is utilized in the production of agrochemicals, where its reactivity and functional groups contribute to the development of effective and targeted pest control agents.
Used in Dye Manufacturing:
In the dye industry, 5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE is employed for the synthesis of specialty dyes. Its chemical properties enable the creation of dyes with specific color characteristics and stability.
Used in Specialty Chemicals:
5-BROMO-2-(AMINOMETHYL)-1,3-DIFLUOROBENZENE is also used in the production of other specialty chemicals, where its versatile properties and reactivity are harnessed to create compounds with unique applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175589-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,5,8 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175589-02:
(8*1)+(7*7)+(6*5)+(5*5)+(4*8)+(3*9)+(2*0)+(1*2)=173
173 % 10 = 3
So 175589-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrClF2/c8-4-1-6(10)5(3-9)7(11)2-4/h1-2H,3H2
175589-02-3Relevant articles and documents
NOVEL 5-AMINO-2-THIOIMIDAZOLE COMPOUNDS AND THEIR USE
-
Page/Page column 46, (2017/04/01)
The present invention is directed to novel compounds of formula (I) pharmaceutically acceptable salts or solvates thereof, and their use.
BRIDGED BICYCLIC KALLIKREIN INHIBITORS
-
Page/Page column 208, (2016/12/26)
Provided herein are kallikrein modulating compounds, pharmaceutical compositions comprising the same, and uses thereof.
