17696-23-0 Usage
Uses
Used in Organic Synthesis:
N,N-Dimethylcyclopropanecarboxamide is utilized as a reagent in organic synthesis for its capacity to facilitate various chemical reactions, contributing to the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, N,N-Dimethylcyclopropanecarboxamide is studied for its potential applications, likely due to its unique structural features and reactivity, which may offer advantages in the development of pharmaceutical compounds.
Used in Catalyst Stabilization:
N,N-Dimethylcyclopropanecarboxamide is employed to stabilize transition metal catalysts, enhancing their performance and longevity in various catalytic processes, which is crucial for improving the efficiency of chemical reactions in industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17696-23-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,6,9 and 6 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 17696-23:
(7*1)+(6*7)+(5*6)+(4*9)+(3*6)+(2*2)+(1*3)=140
140 % 10 = 0
So 17696-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO/c1-7(2)6(8)5-3-4-5/h5H,3-4H2,1-2H3
