1785-09-7 Usage
Uses
Used in Organic Synthesis:
2,7-dibromo-9H-fluoren-4-amine serves as a versatile building block in organic synthesis, facilitating the creation of a wide range of chemical compounds. Its reactivity and structural features make it a valuable intermediate for the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,7-dibromo-9H-fluoren-4-amine is utilized as a key component in the development of new drug molecules. Its unique structure allows for the design of pharmacological agents with specific therapeutic properties, potentially leading to the discovery of novel treatments for various diseases.
Used in Dye Production:
2,7-dibromo-9H-fluoren-4-amine's fluorescent properties make it suitable for use in the production of dyes. These dyes can be employed in various applications, including as colorants in industrial processes or as markers in scientific research.
Used in Organic Electronics:
2,7-dibromo-9H-fluoren-4-amine has been explored for its potential applications in organic electronics. Its fluorescent characteristics are particularly useful in the development of sensors and imaging agents, where it can serve as a fluorescent probe to detect and monitor specific substances or conditions.
Used in Research and Development:
2,7-dibromo-9H-fluoren-4-amine's potential applications in various fields have made it a subject of interest for research and development. Scientists and chemists are investigating its properties and possible uses to expand its utility and contribute to advancements in multiple industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1785-09-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,8 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1785-09:
(6*1)+(5*7)+(4*8)+(3*5)+(2*0)+(1*9)=97
97 % 10 = 7
So 1785-09-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H9Br2N/c14-9-1-2-11-7(4-9)3-8-5-10(15)6-12(16)13(8)11/h1-2,4-6H,3,16H2
1785-09-7Relevant academic research and scientific papers
Oldridge, Luke,Kastler, Marcel,Muellen, Klaus
, p. 885 - 887 (2006)
The synthesis and characterisation of a soluble poly(fluorenone) is presented, a polymer with high electron affinity with potential for use in plastic electronic devices as an n-type material. The Royal Society of Chemistry 2006.
