180-50-7 Usage
General Description
2,8-DIAZASPIRO[5,5]UNDECANE, also known as spiro[5.5]undecane or 2,8-diazabicyclo[4.4.0]decane, is a bicyclic organic compound with a spiro skeleton. It consists of two nitrogen atoms and eleven carbon atoms arranged in a unique molecular structure. This chemical is used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. It has also been studied for its potential as a chiral auxiliary in asymmetric synthesis. Additionally, research has shown that 2,8-DIAZASPIRO[5,5]UNDECANE has potential applications in the field of coordination chemistry and catalysis. Due to its unique structural features, this chemical has garnered interest in various scientific fields for its potential as a versatile and valuable building block for the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 180-50-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,8 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 180-50:
(5*1)+(4*8)+(3*0)+(2*5)+(1*0)=47
47 % 10 = 7
So 180-50-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2/c1-3-9(7-10-5-1)4-2-6-11-8-9/h10-11H,1-8H2
