180741-30-4 Usage
Uses
Used in Organic Chemistry:
2-PIPERIDIN-4-YL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE DIHYDROCHLORIDE is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure and functional groups make it a valuable building block in the development of new molecules with specific properties and applications.
Used in Pharmaceutical Industry:
2-PIPERIDIN-4-YL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE DIHYDROCHLORIDE is used as a potential drug candidate for the development of new therapeutic agents. Its tetrahydroisoquinoline core and piperidinyl substituent may contribute to its biological activity, making it a promising scaffold for the design of novel drugs targeting specific receptors or enzymes.
Used in Biochemical Research:
2-PIPERIDIN-4-YL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE DIHYDROCHLORIDE is used as a research tool in biochemical studies to investigate its interactions with various biological targets, such as proteins, enzymes, or receptors. Understanding its binding properties and mechanism of action can provide insights into its potential therapeutic applications and guide the development of more effective and selective compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 180741-30-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,7,4 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 180741-30:
(8*1)+(7*8)+(6*0)+(5*7)+(4*4)+(3*1)+(2*3)+(1*0)=124
124 % 10 = 4
So 180741-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2/c1-5-2-3-8(7-5)4-6(9)10/h2-3H,4H2,1H3,(H,9,10)
