181305-71-5 Usage
Uses
Used in Fragrance Industry:
2-Chloro-4-fluorophenetole is utilized as a fragrance ingredient, adding a pleasant and floral aroma to various cosmetic and personal care products. Its unique scent profile makes it a valuable addition to the formulations of perfumes, lotions, and other beauty products.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2-chloro-4-fluorophenetole serves as a crucial intermediate in the synthesis of various organic compounds. Its chemical properties allow it to be a building block for the development of new drugs, contributing to the advancement of medical treatments.
Safety Precautions:
Due to its flammable nature and potential to cause irritation to the skin, eyes, and respiratory system, it is essential to handle 2-chloro-4-fluorophenetole with care. Proper safety measures should be implemented to minimize the risk of health hazards and ensure the safe use of 2-CHLORO-4-FLUOROPHENETOLE in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 181305-71-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,1,3,0 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 181305-71:
(8*1)+(7*8)+(6*1)+(5*3)+(4*0)+(3*5)+(2*7)+(1*1)=115
115 % 10 = 5
So 181305-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClFO/c1-2-11-8-4-3-6(10)5-7(8)9/h3-5H,2H2,1H3
