1820-94-6 Usage
Properties
Contains an amino group and a hydroxyethyl group
Methyl group attached to the fourth carbon atom
Specific content
Used as a precursor in the synthesis of pharmaceuticals and organic compounds
Building block in the production of agrochemicals and functional materials
Investigated for potential biological activities such as antimicrobial and antioxidant properties
Versatile with potential applications in various industries
Check Digit Verification of cas no
The CAS Registry Mumber 1820-94-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,2 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1820-94:
(6*1)+(5*8)+(4*2)+(3*0)+(2*9)+(1*4)=76
76 % 10 = 6
So 1820-94-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2OS/c1-3-5(4(2)9)10-6(7)8-3/h4,9H,1-2H3,(H2,7,8)