183483-29-6 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-4-pyridine acetic acid is used as a chemical intermediate for the synthesis of various bioactive compounds, which are essential in the development of pharmaceutical products. Its role in the synthesis process is crucial for creating new drugs with potential therapeutic applications.
Used in Chemical Research:
2-Bromo-4-pyridine acetic acid is used as a research compound in the field of organic chemistry. It serves as a valuable building block for the creation of more complex molecules, which can be studied for their chemical properties and potential applications in various industries.
Used in Material Science:
2-Bromo-4-pyridine acetic acid is used as a precursor in the development of new materials with specific properties. Its unique structure allows for the creation of materials with tailored characteristics, such as improved stability or enhanced reactivity, which can be utilized in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 183483-29-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,3,4,8 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 183483-29:
(8*1)+(7*8)+(6*3)+(5*4)+(4*8)+(3*3)+(2*2)+(1*9)=156
156 % 10 = 6
So 183483-29-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrNO2/c8-6-3-5(1-2-9-6)4-7(10)11/h1-3H,4H2,(H,10,11)
183483-29-6Relevant articles and documents
SHMT INHIBITORS AND USES THEREOF
-
Paragraph 00242, (2018/06/30)
The present invention provides compounds, compositions thereof, and methods of using the same.
Novel Heterocyclic Derivatives and Their Use in the Treatment of Neurological Disorders
-
, (2012/07/28)
The invention relates to novel heterocyclic compounds of the formula in which all of the variables are as defined in the specification, pharmaceutical compositions thereof, combinations thereof, and their use as medicaments, particularly for the treatment of Alzheimer's Disease or diabetes via inhibition of BACE-1 or BACE-2.
