18781-31-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Acetyl-3-methylbenzo[b]thiophene is used as a key intermediate in the synthesis of various pharmaceuticals for its potential antiviral, antifungal, and anti-inflammatory properties. Its unique structure allows for the development of new drugs targeting a wide range of diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Acetyl-3-methylbenzo[b]thiophene is utilized as a building block in the creation of novel agrochemicals, such as pesticides and herbicides. Its biological activities contribute to the development of effective solutions for crop protection and management.
Used in Chemical Research:
2-Acetyl-3-methylbenzo[b]thiophene is employed as a research compound in various scientific studies, particularly in the field of organic chemistry. Its unique structure and properties make it an interesting subject for investigations into new synthetic pathways, potential applications, and understanding its biological activities in greater detail.
Check Digit Verification of cas no
The CAS Registry Mumber 18781-31-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,7,8 and 1 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 18781-31:
(7*1)+(6*8)+(5*7)+(4*8)+(3*1)+(2*3)+(1*1)=132
132 % 10 = 2
So 18781-31-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3
