18853-42-4 Usage
Uses
Used in Organic Synthesis:
Thiophene-2,3-dicarbonitrile serves as a versatile building block in organic synthesis, enabling the creation of a variety of complex organic molecules through multiple chemical reactions. Its unique structure and functional groups make it a valuable intermediate in the synthesis of various organic compounds.
Used in Pharmaceutical Production:
Thiophene-2,3-dicarbonitrile is utilized as a key component in the development of pharmaceuticals. Its incorporation into drug molecules can potentially enhance their therapeutic properties, making it an essential building block in the pharmaceutical industry.
Used in Agrochemical Production:
In the agrochemical sector, thiophene-2,3-dicarbonitrile is employed as a crucial constituent in the synthesis of various agrochemicals. Its unique chemical properties contribute to the development of effective pesticides, herbicides, and other agricultural chemicals, thereby supporting agricultural productivity and crop protection.
Check Digit Verification of cas no
The CAS Registry Mumber 18853-42-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,5 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 18853-42:
(7*1)+(6*8)+(5*8)+(4*5)+(3*3)+(2*4)+(1*2)=134
134 % 10 = 4
So 18853-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H2N2S/c7-3-5-1-2-9-6(5)4-8/h1-2H
18853-42-4Relevant academic research and scientific papers
Preparation and characterization of nonclassical tetraazaporphyrin, bis(4-methylpyridine)[1,3,5,7,9,11,13,15-octaphenyltetra(3,4-thieno) tetraazaporphyrinato]ruthenium(II)
Kimura, Takeshi,Iwama, Takashi,Namauo, Toshiharu,Suzuki, Eiichi,Fukuda, Takamitsu,Kobayashi, Nagao,Sasamori, Takahiro,Tokitoh, Norihiro
experimental part, p. 888 - 894 (2011/05/04)
The tetramerization reaction of 2,5-diphenyl-3,4-dicyanothiophene (2) proceeded on treatment with ruthenium(III) trichloride, DBU, and 4-methylpyridine in 2-ethoxyethanol at 135 °C to give bis(4-methylpyridine) [1,3,5,7,9,11,13,15-octaphenyltetra(3,4-thie
